C23H24N2O2 — CID 2091172
4-acetyl-N-benzhydryl-N,3,5-trimethyl-1H-pyrrole-2-carboxamide (PubChem CID 2091172) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 4-acetyl-N-benzhydryl-N,3,5-trimethyl-1H-pyrrole-2-carboxamide.
| Compound Name | 4-acetyl-N-benzhydryl-N,3,5-trimethyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 2091172 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 4-acetyl-N-benzhydryl-N,3,5-trimethyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)N(C)C(c2ccccc2)c2ccccc2)c1C |
| InChI | InChI=1S/C23H24N2O2/c1-15-20(17(3)26)16(2)24-21(15)23(27)25(4)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,22,24H,1-4H3 |
| InChIKey | IPFMNSZGSOGJDX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |