C24H30N6O — CID 20912350
N-(2,5-dimethylphenyl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide (PubChem CID 20912350) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 20912350 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | N-(2,5-dimethylphenyl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(C)c(NC(=O)C2CCCN(c3ncnc4c3nc3n4CCCCC3)C2)c1 |
| InChI | InChI=1S/C24H30N6O/c1-16-9-10-17(2)19(13-16)27-24(31)18-7-6-11-29(14-18)22-21-23(26-15-25-22)30-12-5-3-4-8-20(30)28-21/h9-10,13,15,18H,3-8,11-12,14H2,1-2H3,(H,27,31) |
| InChIKey | ATBMTEJCVSJUJS-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |