C23H25N7OS — CID 20912437
N-(1,3-benzothiazol-2-yl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-4-carboxamide (PubChem CID 20912437) has the molecular formula C23H25N7OS and a molecular weight of 447.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20912437 |
| Molecular Formula | C23H25N7OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-(7,8,9,10-tetrahydro-6H-purino[9,8-a]azepin-4-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)C1CCN(c2ncnc3c2nc2n3CCCCC2)CC1 |
| InChI | InChI=1S/C23H25N7OS/c31-22(28-23-26-16-6-3-4-7-17(16)32-23)15-9-12-29(13-10-15)20-19-21(25-14-24-20)30-11-5-1-2-8-18(30)27-19/h3-4,6-7,14-15H,1-2,5,8-13H2,(H,26,28,31) |
| InChIKey | YMQHVSHUNPRGIN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |