C12H17N5O — CID 20912624
N-(2-methoxyethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine (PubChem CID 20912624) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is N-(2-methoxyethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine.
| Compound Name | N-(2-methoxyethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
|---|---|
| PubChem CID | 20912624 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N-(2-methoxyethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
| SMILES | COCCNc1ncnc2c1nc1n2CCCC1 |
| InChI | InChI=1S/C12H17N5O/c1-18-7-5-13-11-10-12(15-8-14-11)17-6-3-2-4-9(17)16-10/h8H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | BNYRMLVLRQBVLY-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|