C13H19N5O — CID 20912626
N-(3-methoxypropyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine (PubChem CID 20912626) has the molecular formula C13H19N5O and a molecular weight of 261.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine.
| Compound Name | N-(3-methoxypropyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
|---|---|
| PubChem CID | 20912626 |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.33 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | N-(3-methoxypropyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
| SMILES | COCCCNc1ncnc2c1nc1n2CCCC1 |
| InChI | InChI=1S/C13H19N5O/c1-19-8-4-6-14-12-11-13(16-9-15-12)18-7-3-2-5-10(18)17-11/h9H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | SZPGZOPPQWZSBN-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|