C17H17N5O2 — CID 20912633
N-(1,3-benzodioxol-5-ylmethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine (PubChem CID 20912633) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
|---|---|
| PubChem CID | 20912633 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-6,7,8,9-tetrahydropurino[9,8-a]pyridin-4-amine |
| SMILES | c1nc(NCc2ccc3c(c2)OCO3)c2nc3n(c2n1)CCCC3 |
| InChI | InChI=1S/C17H17N5O2/c1-2-6-22-14(3-1)21-15-16(19-9-20-17(15)22)18-8-11-4-5-12-13(7-11)24-10-23-12/h4-5,7,9H,1-3,6,8,10H2,(H,18,19,20) |
| InChIKey | XRELILXMEIBQSR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |