About N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide
N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide (PubChem CID 2091318) has the molecular formula C15H15N3O2S
and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide |
| PubChem CID | 2091318 |
| Molecular Formula | C15H15N3O2S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)Nc2ccc3cn[nH]c3c2)c1 |
| InChI | InChI=1S/C15H15N3O2S/c1-10-3-4-11(2)15(7-10)21(19,20)18-13-6-5-12-9-16-17-14(12)8-13/h3-9,18H,1-2H3,(H,16,17) |
| InChIKey | VUHYSCDSOPSSAC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide?
The IUPAC name of N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide (CID 2091318) is N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide.
What is the SMILES notation for N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide?
The canonical SMILES for N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide is Cc1ccc(C)c(S(=O)(=O)Nc2ccc3cn[nH]c3c2)c1.
What is the InChIKey of N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide?
The InChIKey is VUHYSCDSOPSSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2S/c1-10-3-4-11(2)15(7-10)21(19,20)18-13-6-5-12-9-16-17-14(12)8-13/h3-9,18H,1-2H3,(H,16,17).
What are the key properties of N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide?
N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide has a molecular weight of 301.37 g/mol, XLogP of 2.98, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-6-yl)-2,5-dimethylbenzenesulfonamide is sourced from PubChem (CID 2091318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).