About pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate
pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate (PubChem CID 20913457) has the molecular formula C15H13NO2S2
and a molecular weight of 303.41 g/mol. Its IUPAC name is pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate.
Molecular Properties
| Compound Name | pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate |
| PubChem CID | 20913457 |
| Molecular Formula | C15H13NO2S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate |
| SMILES | Cc1sc2c(c1C)CSC(C(=O)Oc1cccnc1)=C2 |
| InChI | InChI=1S/C15H13NO2S2/c1-9-10(2)20-13-6-14(19-8-12(9)13)15(17)18-11-4-3-5-16-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | NHWQWHRAKNMVQX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate?
The IUPAC name of pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate (CID 20913457) is pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate.
What is the SMILES notation for pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate?
The canonical SMILES for pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate is Cc1sc2c(c1C)CSC(C(=O)Oc1cccnc1)=C2.
What is the InChIKey of pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate?
The InChIKey is NHWQWHRAKNMVQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2S2/c1-9-10(2)20-13-6-14(19-8-12(9)13)15(17)18-11-4-3-5-16-7-11/h3-7H,8H2,1-2H3.
What are the key properties of pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate?
pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate has a molecular weight of 303.41 g/mol, XLogP of 3.95, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-yl 2,3-dimethyl-4H-thieno[3,2-c]thiopyran-6-carboxylate is sourced from PubChem (CID 20913457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).