C21H20N2O3 — CID 2091364
(2-anilino-2-oxoethyl) 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate (PubChem CID 2091364) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate.
| Compound Name | (2-anilino-2-oxoethyl) 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 2091364 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | (2-anilino-2-oxoethyl) 6,7,8,9-tetrahydro-5H-carbazole-3-carboxylate |
| SMILES | O=C(COC(=O)c1ccc2[nH]c3c(c2c1)CCCC3)Nc1ccccc1 |
| InChI | InChI=1S/C21H20N2O3/c24-20(22-15-6-2-1-3-7-15)13-26-21(25)14-10-11-19-17(12-14)16-8-4-5-9-18(16)23-19/h1-3,6-7,10-12,23H,4-5,8-9,13H2,(H,22,24) |
| InChIKey | RFQMZGJBWPWXMW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|