C15H16ClN3OS — CID 20913823
N-(2-chlorophenyl)-2-methylsulfanyl-4-propylpyrimidine-5-carboxamide (PubChem CID 20913823) has the molecular formula C15H16ClN3OS and a molecular weight of 321.83 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-methylsulfanyl-4-propylpyrimidine-5-carboxamide.
| Compound Name | N-(2-chlorophenyl)-2-methylsulfanyl-4-propylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 20913823 |
| Molecular Formula | C15H16ClN3OS |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-methylsulfanyl-4-propylpyrimidine-5-carboxamide |
| SMILES | CCCc1nc(SC)ncc1C(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C15H16ClN3OS/c1-3-6-12-10(9-17-15(19-12)21-2)14(20)18-13-8-5-4-7-11(13)16/h4-5,7-9H,3,6H2,1-2H3,(H,18,20) |
| InChIKey | JZHFHDWWMAFTGB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |