About 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide
2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide (PubChem CID 20914) has the molecular formula C5H13Br2N3S
and a molecular weight of 307.06 g/mol. Its IUPAC name is 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide.
Molecular Properties
| Compound Name | 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide |
| PubChem CID | 20914 |
| Molecular Formula | C5H13Br2N3S |
| Molecular Weight | 307.06 g/mol |
| Exact Mass | 304.92 |
| IUPAC Name | 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide |
| SMILES | [Br-].[Br-].[NH3+]CCSC1=NCC[NH2+]1 |
| InChI | InChI=1S/C5H11N3S.2BrH/c6-1-4-9-5-7-2-3-8-5;;/h1-4,6H2,(H,7,8);2*1H |
| InChIKey | FJHHFAMLIUZDQF-UHFFFAOYSA-N |
| XLogP | -8.10 |
| TPSA | 56.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.06 |
| LogP ≤ 5 | -8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide?
The IUPAC name of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide (CID 20914) is 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide.
What is the SMILES notation for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide?
The canonical SMILES for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide is [Br-].[Br-].[NH3+]CCSC1=NCC[NH2+]1.
What is the InChIKey of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide?
The InChIKey is FJHHFAMLIUZDQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3S.2BrH/c6-1-4-9-5-7-2-3-8-5;;/h1-4,6H2,(H,7,8);2*1H.
What are the key properties of 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide?
2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide has a molecular weight of 307.06 g/mol, XLogP of -8.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)ethylazanium dibromide is sourced from PubChem (CID 20914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).