About 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide (PubChem CID 2091432) has the molecular formula C18H17N3O3
and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide |
| PubChem CID | 2091432 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C18H17N3O3/c1-19-15(22)12-21-16(23)18(20-17(21)24,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | FEOJSMSDRHNZND-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide?
The IUPAC name of 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide (CID 2091432) is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide.
What is the SMILES notation for 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide?
The canonical SMILES for 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide is CNC(=O)CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O.
What is the InChIKey of 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide?
The InChIKey is FEOJSMSDRHNZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3O3/c1-19-15(22)12-21-16(23)18(20-17(21)24,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11H,12H2,1H3,(H,19,22)(H,20,24).
What are the key properties of 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide?
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide has a molecular weight of 323.35 g/mol, XLogP of 1.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-methylacetamide is sourced from PubChem (CID 2091432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).