C21H20ClN3O2 — CID 20914425
3-(3-chlorophenyl)-5,8-dimethyl-1-propylpyrimido[5,4-b]indole-2,4-dione (PubChem CID 20914425) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-5,8-dimethyl-1-propylpyrimido[5,4-b]indole-2,4-dione.
| Compound Name | 3-(3-chlorophenyl)-5,8-dimethyl-1-propylpyrimido[5,4-b]indole-2,4-dione |
|---|---|
| PubChem CID | 20914425 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-(3-chlorophenyl)-5,8-dimethyl-1-propylpyrimido[5,4-b]indole-2,4-dione |
| SMILES | CCCn1c(=O)n(-c2cccc(Cl)c2)c(=O)c2c1c1cc(C)ccc1n2C |
| InChI | InChI=1S/C21H20ClN3O2/c1-4-10-24-18-16-11-13(2)8-9-17(16)23(3)19(18)20(26)25(21(24)27)15-7-5-6-14(22)12-15/h5-9,11-12H,4,10H2,1-3H3 |
| InChIKey | ICNSKEAJCXZEDV-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |