C24H28FN5O — CID 20915390
(4-cyclohexylpiperazin-1-yl)-[1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]methanone (PubChem CID 20915390) has the molecular formula C24H28FN5O and a molecular weight of 421.52 g/mol. Its IUPAC name is (4-cyclohexylpiperazin-1-yl)-[1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]methanone.
| Compound Name | (4-cyclohexylpiperazin-1-yl)-[1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 20915390 |
| Molecular Formula | C24H28FN5O |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (4-cyclohexylpiperazin-1-yl)-[1-(4-fluorophenyl)-5-pyrrol-1-ylpyrazol-4-yl]methanone |
| SMILES | O=C(c1cnn(-c2ccc(F)cc2)c1-n1cccc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H28FN5O/c25-19-8-10-21(11-9-19)30-23(28-12-4-5-13-28)22(18-26-30)24(31)29-16-14-27(15-17-29)20-6-2-1-3-7-20/h4-5,8-13,18,20H,1-3,6-7,14-17H2 |
| InChIKey | LWVGRLNVEFHYSY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |