C23H23NO5 — CID 20915636
ethyl 4-(3-ethyl-4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate (PubChem CID 20915636) has the molecular formula C23H23NO5 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 4-(3-ethyl-4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate.
| Compound Name | ethyl 4-(3-ethyl-4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
|---|---|
| PubChem CID | 20915636 |
| Molecular Formula | C23H23NO5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | ethyl 4-(3-ethyl-4-methyl-2-oxo-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-9-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(N2COc3ccc4c(C)c(CC)c(=O)oc4c3C2)cc1 |
| InChI | InChI=1S/C23H23NO5/c1-4-17-14(3)18-10-11-20-19(21(18)29-23(17)26)12-24(13-28-20)16-8-6-15(7-9-16)22(25)27-5-2/h6-11H,4-5,12-13H2,1-3H3 |
| InChIKey | GVDOYCHAKMLGAE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|