C22H23N3O4 — CID 20915810
5-methoxy-N-(3-methoxyphenyl)-1-methyl-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide (PubChem CID 20915810) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 5-methoxy-N-(3-methoxyphenyl)-1-methyl-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide.
| Compound Name | 5-methoxy-N-(3-methoxyphenyl)-1-methyl-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 20915810 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 5-methoxy-N-(3-methoxyphenyl)-1-methyl-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2c(N3CCCC3=O)c3cc(OC)ccc3n2C)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-24-18-10-9-16(29-3)13-17(18)20(25-11-5-8-19(25)26)21(24)22(27)23-14-6-4-7-15(12-14)28-2/h4,6-7,9-10,12-13H,5,8,11H2,1-3H3,(H,23,27) |
| InChIKey | PAENKFQCFQPXGD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |