C24H34FN5O2 — CID 20915958
1-ethyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-5-fluoro-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide (PubChem CID 20915958) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 1-ethyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-5-fluoro-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide.
| Compound Name | 1-ethyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-5-fluoro-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide |
|---|---|
| PubChem CID | 20915958 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 1-ethyl-N-[3-(4-ethylpiperazin-1-yl)propyl]-5-fluoro-3-(2-oxopyrrolidin-1-yl)indole-2-carboxamide |
| SMILES | CCN1CCN(CCCNC(=O)c2c(N3CCCC3=O)c3cc(F)ccc3n2CC)CC1 |
| InChI | InChI=1S/C24H34FN5O2/c1-3-27-13-15-28(16-14-27)11-6-10-26-24(32)23-22(30-12-5-7-21(30)31)19-17-18(25)8-9-20(19)29(23)4-2/h8-9,17H,3-7,10-16H2,1-2H3,(H,26,32) |
| InChIKey | BIGPXWXUBUAAOW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|