About 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide
3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide (PubChem CID 20916) has the molecular formula C6H15Br2N3S
and a molecular weight of 321.08 g/mol. Its IUPAC name is 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide.
Molecular Properties
| Compound Name | 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide |
| PubChem CID | 20916 |
| Molecular Formula | C6H15Br2N3S |
| Molecular Weight | 321.08 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide |
| SMILES | [Br-].[Br-].[NH3+]CCCSC1=NCC[NH2+]1 |
| InChI | InChI=1S/C6H13N3S.2BrH/c7-2-1-5-10-6-8-3-4-9-6;;/h1-5,7H2,(H,8,9);2*1H |
| InChIKey | QLDDSOKYEWDEJW-UHFFFAOYSA-N |
| XLogP | -7.71 |
| TPSA | 56.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.08 |
| LogP ≤ 5 | -7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide?
The IUPAC name of 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide (CID 20916) is 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide.
What is the SMILES notation for 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide?
The canonical SMILES for 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide is [Br-].[Br-].[NH3+]CCCSC1=NCC[NH2+]1.
What is the InChIKey of 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide?
The InChIKey is QLDDSOKYEWDEJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3S.2BrH/c7-2-1-5-10-6-8-3-4-9-6;;/h1-5,7H2,(H,8,9);2*1H.
What are the key properties of 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide?
3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide has a molecular weight of 321.08 g/mol, XLogP of -7.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dihydro-1H-imidazol-1-ium-2-ylsulfanyl)propylazanium dibromide is sourced from PubChem (CID 20916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).