C27H30N2O3 — CID 20916665
N-[2-(cyclohexen-1-yl)ethyl]-4-[5-methyl-4-[(4-methylphenoxy)methyl]-1,3-oxazol-2-yl]benzamide (PubChem CID 20916665) has the molecular formula C27H30N2O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[5-methyl-4-[(4-methylphenoxy)methyl]-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[5-methyl-4-[(4-methylphenoxy)methyl]-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 20916665 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[5-methyl-4-[(4-methylphenoxy)methyl]-1,3-oxazol-2-yl]benzamide |
| SMILES | Cc1ccc(OCc2nc(-c3ccc(C(=O)NCCC4=CCCCC4)cc3)oc2C)cc1 |
| InChI | InChI=1S/C27H30N2O3/c1-19-8-14-24(15-9-19)31-18-25-20(2)32-27(29-25)23-12-10-22(11-13-23)26(30)28-17-16-21-6-4-3-5-7-21/h6,8-15H,3-5,7,16-18H2,1-2H3,(H,28,30) |
| InChIKey | QNFFRXAWCWEOJO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|