C22H24N2O2S — CID 20916826
N-butyl-4-[5-methyl-4-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 20916826) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-butyl-4-[5-methyl-4-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-butyl-4-[5-methyl-4-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 20916826 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-butyl-4-[5-methyl-4-(phenylsulfanylmethyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | CCCCNC(=O)c1ccc(-c2nc(CSc3ccccc3)c(C)o2)cc1 |
| InChI | InChI=1S/C22H24N2O2S/c1-3-4-14-23-21(25)17-10-12-18(13-11-17)22-24-20(16(2)26-22)15-27-19-8-6-5-7-9-19/h5-13H,3-4,14-15H2,1-2H3,(H,23,25) |
| InChIKey | OIQLICYLJXLBDO-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|