C20H16ClNO2 — CID 20917336
3-(4-chlorophenyl)-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)cyclobut-3-ene-1,2-dione (PubChem CID 20917336) has the molecular formula C20H16ClNO2 and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20917336 |
| Molecular Formula | C20H16ClNO2 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(5,6,7,8-tetrahydronaphthalen-1-ylamino)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2cccc3c2CCCC3)c(-c2ccc(Cl)cc2)c1=O |
| InChI | InChI=1S/C20H16ClNO2/c21-14-10-8-13(9-11-14)17-18(20(24)19(17)23)22-16-7-3-5-12-4-1-2-6-15(12)16/h3,5,7-11,22H,1-2,4,6H2 |
| InChIKey | SCXVCIASGPVXMS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|