About 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 20917681) has the molecular formula C17H13N3O5S2
and a molecular weight of 403.44 g/mol. Its IUPAC name is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
| PubChem CID | 20917681 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)NCc2ccco2)s1 |
| InChI | InChI=1S/C17H13N3O5S2/c21-16-13-4-1-7-18-15(13)17(22)20(16)10-12-5-6-14(26-12)27(23,24)19-9-11-3-2-8-25-11/h1-8,19H,9-10H2 |
| InChIKey | UIOPYIOWKZSCRW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide?
The IUPAC name of 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide (CID 20917681) is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide is O=C1c2cccnc2C(=O)N1Cc1ccc(S(=O)(=O)NCc2ccco2)s1.
What is the InChIKey of 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide?
The InChIKey is UIOPYIOWKZSCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13N3O5S2/c21-16-13-4-1-7-18-15(13)17(22)20(16)10-12-5-6-14(26-12)27(23,24)19-9-11-3-2-8-25-11/h1-8,19H,9-10H2.
What are the key properties of 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide?
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide has a molecular weight of 403.44 g/mol, XLogP of 2.01, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-N-(furan-2-ylmethyl)thiophene-2-sulfonamide is sourced from PubChem (CID 20917681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).