C22H24FN3O4S — CID 20917795
N-cyclooctyl-2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzenesulfonamide (PubChem CID 20917795) has the molecular formula C22H24FN3O4S and a molecular weight of 445.52 g/mol. Its IUPAC name is N-cyclooctyl-2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzenesulfonamide.
| Compound Name | N-cyclooctyl-2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 20917795 |
| Molecular Formula | C22H24FN3O4S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | N-cyclooctyl-2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluorobenzenesulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(F)cc1S(=O)(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C22H24FN3O4S/c23-16-11-10-15(14-26-21(27)18-9-6-12-24-20(18)22(26)28)19(13-16)31(29,30)25-17-7-4-2-1-3-5-8-17/h6,9-13,17,25H,1-5,7-8,14H2 |
| InChIKey | CYCQMWMLWCDOAV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|