C23H18FN3O4S — CID 20917823
6-[[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-fluorophenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20917823) has the molecular formula C23H18FN3O4S and a molecular weight of 451.48 g/mol. Its IUPAC name is 6-[[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-fluorophenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-fluorophenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20917823 |
| Molecular Formula | C23H18FN3O4S |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 6-[[2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)-4-fluorophenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(F)cc1S(=O)(=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C23H18FN3O4S/c24-18-8-7-17(14-27-22(28)19-6-3-10-25-21(19)23(27)29)20(12-18)32(30,31)26-11-9-15-4-1-2-5-16(15)13-26/h1-8,10,12H,9,11,13-14H2 |
| InChIKey | NNWJTCOZXUNLIL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 87.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|