C24H20FN3O4S — CID 20917875
2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide (PubChem CID 20917875) has the molecular formula C24H20FN3O4S and a molecular weight of 465.51 g/mol. Its IUPAC name is 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 20917875 |
| Molecular Formula | C24H20FN3O4S |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | 2-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-5-fluoro-N-(5,6,7,8-tetrahydronaphthalen-1-yl)benzenesulfonamide |
| SMILES | O=C1c2cccnc2C(=O)N1Cc1ccc(F)cc1S(=O)(=O)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C24H20FN3O4S/c25-17-11-10-16(14-28-23(29)19-8-4-12-26-22(19)24(28)30)21(13-17)33(31,32)27-20-9-3-6-15-5-1-2-7-18(15)20/h3-4,6,8-13,27H,1-2,5,7,14H2 |
| InChIKey | XAJAAMLJXPUYLZ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|