About [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone
[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 20918344) has the molecular formula C18H23N3O
and a molecular weight of 297.40 g/mol. Its IUPAC name is [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone.
Molecular Properties
| Compound Name | [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone |
| PubChem CID | 20918344 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCCCC3C)[nH]n2)cc1C |
| InChI | InChI=1S/C18H23N3O/c1-12-7-8-15(10-13(12)2)16-11-17(20-19-16)18(22)21-9-5-4-6-14(21)3/h7-8,10-11,14H,4-6,9H2,1-3H3,(H,19,20) |
| InChIKey | HLWSYHZFDGZOOY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone?
The IUPAC name of [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone (CID 20918344) is [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone.
What is the SMILES notation for [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone?
The canonical SMILES for [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone is Cc1ccc(-c2cc(C(=O)N3CCCCC3C)[nH]n2)cc1C.
What is the InChIKey of [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone?
The InChIKey is HLWSYHZFDGZOOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O/c1-12-7-8-15(10-13(12)2)16-11-17(20-19-16)18(22)21-9-5-4-6-14(21)3/h7-8,10-11,14H,4-6,9H2,1-3H3,(H,19,20).
What are the key properties of [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone?
[3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone has a molecular weight of 297.40 g/mol, XLogP of 3.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,4-dimethylphenyl)-1H-pyrazol-5-yl]-(2-methylpiperidin-1-yl)methanone is sourced from PubChem (CID 20918344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).