C17H24N4O — CID 20919353
N-butan-2-yl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919353) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-butan-2-yl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-butan-2-yl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919353 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-butan-2-yl-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | CCC(C)NC(=O)c1cnn2c3c(cnc12)CCCCCC3 |
| InChI | InChI=1S/C17H24N4O/c1-3-12(2)20-17(22)14-11-19-21-15-9-7-5-4-6-8-13(15)10-18-16(14)21/h10-12H,3-9H2,1-2H3,(H,20,22) |
| InChIKey | CLDQTIDGIMJSFK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |