C20H28N4O — CID 20919389
N-(2-methylcyclohexyl)-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919389) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-(2-methylcyclohexyl)-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919389 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | N-(2-methylcyclohexyl)-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | CC1CCCCC1NC(=O)c1cnn2c3c(cnc12)CCCCCC3 |
| InChI | InChI=1S/C20H28N4O/c1-14-8-6-7-10-17(14)23-20(25)16-13-22-24-18-11-5-3-2-4-9-15(18)12-21-19(16)24/h12-14,17H,2-11H2,1H3,(H,23,25) |
| InChIKey | HLHDUDXRJKNQPB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |