C21H28N4O — CID 20919395
N-[2-(cyclohexen-1-yl)ethyl]-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide (PubChem CID 20919395) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 20919395 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraene-5-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cnn2c3c(cnc12)CCCCCC3 |
| InChI | InChI=1S/C21H28N4O/c26-21(22-13-12-16-8-4-3-5-9-16)18-15-24-25-19-11-7-2-1-6-10-17(19)14-23-20(18)25/h8,14-15H,1-7,9-13H2,(H,22,26) |
| InChIKey | YUFISUMEWZOBKJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|