C18H25N5O — CID 20919419
(4-methylpiperazin-1-yl)-(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone (PubChem CID 20919419) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)-(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone.
| Compound Name | (4-methylpiperazin-1-yl)-(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone |
|---|---|
| PubChem CID | 20919419 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | (4-methylpiperazin-1-yl)-(2,3,7-triazatricyclo[7.6.0.02,6]pentadeca-1(9),3,5,7-tetraen-5-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cnn3c4c(cnc23)CCCCCC4)CC1 |
| InChI | InChI=1S/C18H25N5O/c1-21-8-10-22(11-9-21)18(24)15-13-20-23-16-7-5-3-2-4-6-14(16)12-19-17(15)23/h12-13H,2-11H2,1H3 |
| InChIKey | YXFVJGPNMCCAQX-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |