About [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate
[2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (PubChem CID 2091944) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
Molecular Properties
| Compound Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| PubChem CID | 2091944 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate |
| SMILES | Cc1cccc(C)c1NC(=O)COC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-4-3-5-12(2)16(11)17-14(18)9-20-15(19)8-13-6-7-21-10-13/h3-7,10H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | FTHFPSVBIOTRDF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The IUPAC name of [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate (CID 2091944) is [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate.
What is the SMILES notation for [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The canonical SMILES for [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate is Cc1cccc(C)c1NC(=O)COC(=O)Cc1ccsc1.
What is the InChIKey of [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
The InChIKey is FTHFPSVBIOTRDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-11-4-3-5-12(2)16(11)17-14(18)9-20-15(19)8-13-6-7-21-10-13/h3-7,10H,8-9H2,1-2H3,(H,17,18).
What are the key properties of [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate?
[2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate has a molecular weight of 303.38 g/mol, XLogP of 3.09, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,6-dimethylanilino)-2-oxoethyl] 2-thiophen-3-ylacetate is sourced from PubChem (CID 2091944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).