C22H29N3O3S — CID 20921519
N-(2,5-dimethylphenyl)-2-[6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]acetamide (PubChem CID 20921519) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-[6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-[6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]acetamide |
|---|---|
| PubChem CID | 20921519 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-[6-[(2,5-dimethylphenyl)methyl]-1,1-dioxo-1,2,6-thiadiazinan-2-yl]acetamide |
| SMILES | Cc1ccc(C)c(CN2CCCN(CC(=O)Nc3cc(C)ccc3C)S2(=O)=O)c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-16-6-8-18(3)20(12-16)14-24-10-5-11-25(29(24,27)28)15-22(26)23-21-13-17(2)7-9-19(21)4/h6-9,12-13H,5,10-11,14-15H2,1-4H3,(H,23,26) |
| InChIKey | APSRCGUUHMWWRJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |