C19H24N2O2S — CID 20921547
2,6-bis[(4-methylphenyl)methyl]-1,2,6-thiadiazinane 1,1-dioxide (PubChem CID 20921547) has the molecular formula C19H24N2O2S and a molecular weight of 344.48 g/mol. Its IUPAC name is 2,6-bis[(4-methylphenyl)methyl]-1,2,6-thiadiazinane 1,1-dioxide.
| Compound Name | 2,6-bis[(4-methylphenyl)methyl]-1,2,6-thiadiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 20921547 |
| Molecular Formula | C19H24N2O2S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2,6-bis[(4-methylphenyl)methyl]-1,2,6-thiadiazinane 1,1-dioxide |
| SMILES | Cc1ccc(CN2CCCN(Cc3ccc(C)cc3)S2(=O)=O)cc1 |
| InChI | InChI=1S/C19H24N2O2S/c1-16-4-8-18(9-5-16)14-20-12-3-13-21(24(20,22)23)15-19-10-6-17(2)7-11-19/h4-11H,3,12-15H2,1-2H3 |
| InChIKey | JZXMVXNHPVGZRK-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |