C15H19ClN4O6S2 — CID 20921896
2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide (PubChem CID 20921896) has the molecular formula C15H19ClN4O6S2 and a molecular weight of 450.93 g/mol. Its IUPAC name is 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide.
| Compound Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 20921896 |
| Molecular Formula | C15H19ClN4O6S2 |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 2-[3,4-bis(methylsulfamoyl)pyrrol-1-yl]-N-(5-chloro-2-methoxyphenyl)acetamide |
| SMILES | CNS(=O)(=O)c1cn(CC(=O)Nc2cc(Cl)ccc2OC)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C15H19ClN4O6S2/c1-17-27(22,23)13-7-20(8-14(13)28(24,25)18-2)9-15(21)19-11-6-10(16)4-5-12(11)26-3/h4-8,17-18H,9H2,1-3H3,(H,19,21) |
| InChIKey | XFURGVHPFLWJIW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 135.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |