About 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline
8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline (PubChem CID 20922976) has the molecular formula C15H18ClN3
and a molecular weight of 275.78 g/mol. Its IUPAC name is 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline.
Molecular Properties
| Compound Name | 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline |
| PubChem CID | 20922976 |
| Molecular Formula | C15H18ClN3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline |
| SMILES | CC1CC(C)CN(c2cnnc3c(Cl)cccc23)C1 |
| InChI | InChI=1S/C15H18ClN3/c1-10-6-11(2)9-19(8-10)14-7-17-18-15-12(14)4-3-5-13(15)16/h3-5,7,10-11H,6,8-9H2,1-2H3 |
| InChIKey | ONLSGEIFPSIZQI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline?
The IUPAC name of 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline (CID 20922976) is 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline.
What is the SMILES notation for 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline?
The canonical SMILES for 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline is CC1CC(C)CN(c2cnnc3c(Cl)cccc23)C1.
What is the InChIKey of 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline?
The InChIKey is ONLSGEIFPSIZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClN3/c1-10-6-11(2)9-19(8-10)14-7-17-18-15-12(14)4-3-5-13(15)16/h3-5,7,10-11H,6,8-9H2,1-2H3.
What are the key properties of 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline?
8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline has a molecular weight of 275.78 g/mol, XLogP of 3.77, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-4-(3,5-dimethylpiperidin-1-yl)cinnoline is sourced from PubChem (CID 20922976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).