C22H25N3O5S — CID 20923169
6-[[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione (PubChem CID 20923169) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 6-[[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione.
| Compound Name | 6-[[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
|---|---|
| PubChem CID | 20923169 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 6-[[3-(3,5-dimethylpiperidin-1-yl)sulfonyl-4-methoxyphenyl]methyl]pyrrolo[3,4-b]pyridine-5,7-dione |
| SMILES | COc1ccc(CN2C(=O)c3cccnc3C2=O)cc1S(=O)(=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C22H25N3O5S/c1-14-9-15(2)12-24(11-14)31(28,29)19-10-16(6-7-18(19)30-3)13-25-21(26)17-5-4-8-23-20(17)22(25)27/h4-8,10,14-15H,9,11-13H2,1-3H3 |
| InChIKey | OKEMWCRXMSXQIK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|