C22H25N3O5S — CID 20923170
5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxy-N-(2-methylcyclohexyl)benzenesulfonamide (PubChem CID 20923170) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxy-N-(2-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxy-N-(2-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 20923170 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 5-[(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)methyl]-2-methoxy-N-(2-methylcyclohexyl)benzenesulfonamide |
| SMILES | COc1ccc(CN2C(=O)c3cccnc3C2=O)cc1S(=O)(=O)NC1CCCCC1C |
| InChI | InChI=1S/C22H25N3O5S/c1-14-6-3-4-8-17(14)24-31(28,29)19-12-15(9-10-18(19)30-2)13-25-21(26)16-7-5-11-23-20(16)22(25)27/h5,7,9-12,14,17,24H,3-4,6,8,13H2,1-2H3 |
| InChIKey | VPRJZSXSPJMNAC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|