About 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide
1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 20923975) has the molecular formula C24H28N4O
and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| PubChem CID | 20923975 |
| Molecular Formula | C24H28N4O |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2ncc(C(=O)Nc3ccccc3C)c2C2CCNCC2)cc1C |
| InChI | InChI=1S/C24H28N4O/c1-16-8-9-20(14-18(16)3)28-23(19-10-12-25-13-11-19)21(15-26-28)24(29)27-22-7-5-4-6-17(22)2/h4-9,14-15,19,25H,10-13H2,1-3H3,(H,27,29) |
| InChIKey | GVUDUOXAZZXPAU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The IUPAC name of 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (CID 20923975) is 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
What is the SMILES notation for 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The canonical SMILES for 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide is Cc1ccc(-n2ncc(C(=O)Nc3ccccc3C)c2C2CCNCC2)cc1C.
What is the InChIKey of 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The InChIKey is GVUDUOXAZZXPAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4O/c1-16-8-9-20(14-18(16)3)28-23(19-10-12-25-13-11-19)21(15-26-28)24(29)27-22-7-5-4-6-17(22)2/h4-9,14-15,19,25H,10-13H2,1-3H3,(H,27,29).
What are the key properties of 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide has a molecular weight of 388.52 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dimethylphenyl)-N-(2-methylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide is sourced from PubChem (CID 20923975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).