About N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide
N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (PubChem CID 20924246) has the molecular formula C22H30N4O
and a molecular weight of 366.51 g/mol. Its IUPAC name is N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| PubChem CID | 20924246 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide |
| SMILES | Cc1cccc(C)c1-n1ncc(C(=O)NC2CCCC2)c1C1CCNCC1 |
| InChI | InChI=1S/C22H30N4O/c1-15-6-5-7-16(2)20(15)26-21(17-10-12-23-13-11-17)19(14-24-26)22(27)25-18-8-3-4-9-18/h5-7,14,17-18,23H,3-4,8-13H2,1-2H3,(H,25,27) |
| InChIKey | NKZFBKUWUIWQEM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The IUPAC name of N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide (CID 20924246) is N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide.
What is the SMILES notation for N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The canonical SMILES for N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide is Cc1cccc(C)c1-n1ncc(C(=O)NC2CCCC2)c1C1CCNCC1.
What is the InChIKey of N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
The InChIKey is NKZFBKUWUIWQEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N4O/c1-15-6-5-7-16(2)20(15)26-21(17-10-12-23-13-11-17)19(14-24-26)22(27)25-18-8-3-4-9-18/h5-7,14,17-18,23H,3-4,8-13H2,1-2H3,(H,25,27).
What are the key properties of N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide?
N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide has a molecular weight of 366.51 g/mol, XLogP of 3.63, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-1-(2,6-dimethylphenyl)-5-piperidin-4-ylpyrazole-4-carboxamide is sourced from PubChem (CID 20924246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).