C21H22BrN3O2 — CID 20924392
1-(4-bromo-2-methylphenyl)-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea (PubChem CID 20924392) has the molecular formula C21H22BrN3O2 and a molecular weight of 428.33 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
|---|---|
| PubChem CID | 20924392 |
| Molecular Formula | C21H22BrN3O2 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-[2-(2-methylpropyl)-1-oxoisoquinolin-4-yl]urea |
| SMILES | Cc1cc(Br)ccc1NC(=O)Nc1cn(CC(C)C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C21H22BrN3O2/c1-13(2)11-25-12-19(16-6-4-5-7-17(16)20(25)26)24-21(27)23-18-9-8-15(22)10-14(18)3/h4-10,12-13H,11H2,1-3H3,(H2,23,24,27) |
| InChIKey | CKGKYSFNDMPWPH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |