C13H16N4O5 — CID 20924759
diethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanedioate (PubChem CID 20924759) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is diethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanedioate.
| Compound Name | diethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanedioate |
|---|---|
| PubChem CID | 20924759 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | diethyl 2-[(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)amino]propanedioate |
| SMILES | CCOC(=O)C(Nc1ncnc2onc(C)c12)C(=O)OCC |
| InChI | InChI=1S/C13H16N4O5/c1-4-20-12(18)9(13(19)21-5-2)16-10-8-7(3)17-22-11(8)15-6-14-10/h6,9H,4-5H2,1-3H3,(H,14,15,16) |
| InChIKey | DIZUCPHXFPCWDP-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|