C25H33N5O3 — CID 20924926
ethyl 6-methyl-4-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propylamino]furo[2,3-d]pyrimidine-5-carboxylate (PubChem CID 20924926) has the molecular formula C25H33N5O3 and a molecular weight of 451.57 g/mol. Its IUPAC name is ethyl 6-methyl-4-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propylamino]furo[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-methyl-4-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propylamino]furo[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 20924926 |
| Molecular Formula | C25H33N5O3 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | ethyl 6-methyl-4-[3-[3-methyl-4-(3-methylphenyl)piperazin-1-yl]propylamino]furo[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(C)oc2ncnc(NCCCN3CCN(c4cccc(C)c4)C(C)C3)c12 |
| InChI | InChI=1S/C25H33N5O3/c1-5-32-25(31)21-19(4)33-24-22(21)23(27-16-28-24)26-10-7-11-29-12-13-30(18(3)15-29)20-9-6-8-17(2)14-20/h6,8-9,14,16,18H,5,7,10-13,15H2,1-4H3,(H,26,27,28) |
| InChIKey | NSXFHWTXBOKGER-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|