C25H34N4O3 — CID 20925092
ethyl 4-[3-[benzyl(butyl)amino]propylamino]-2,6-dimethylfuro[2,3-d]pyrimidine-5-carboxylate (PubChem CID 20925092) has the molecular formula C25H34N4O3 and a molecular weight of 438.57 g/mol. Its IUPAC name is ethyl 4-[3-[benzyl(butyl)amino]propylamino]-2,6-dimethylfuro[2,3-d]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-[benzyl(butyl)amino]propylamino]-2,6-dimethylfuro[2,3-d]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 20925092 |
| Molecular Formula | C25H34N4O3 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | ethyl 4-[3-[benzyl(butyl)amino]propylamino]-2,6-dimethylfuro[2,3-d]pyrimidine-5-carboxylate |
| SMILES | CCCCN(CCCNc1nc(C)nc2oc(C)c(C(=O)OCC)c12)Cc1ccccc1 |
| InChI | InChI=1S/C25H34N4O3/c1-5-7-15-29(17-20-12-9-8-10-13-20)16-11-14-26-23-22-21(25(30)31-6-2)18(3)32-24(22)28-19(4)27-23/h8-10,12-13H,5-7,11,14-17H2,1-4H3,(H,26,27,28) |
| InChIKey | KVRSIFCFWPKUHL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|