C19H14ClN3O2 — CID 20925522
N-(3-chloro-4-methoxyphenyl)-1H-pyrrolo[3,2-h]quinoline-2-carboxamide (PubChem CID 20925522) has the molecular formula C19H14ClN3O2 and a molecular weight of 351.79 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-1H-pyrrolo[3,2-h]quinoline-2-carboxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-1H-pyrrolo[3,2-h]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 20925522 |
| Molecular Formula | C19H14ClN3O2 |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-1H-pyrrolo[3,2-h]quinoline-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccc4cccnc4c3[nH]2)cc1Cl |
| InChI | InChI=1S/C19H14ClN3O2/c1-25-16-7-6-13(10-14(16)20)22-19(24)15-9-12-5-4-11-3-2-8-21-17(11)18(12)23-15/h2-10,23H,1H3,(H,22,24) |
| InChIKey | UKXBDVIWEYIURD-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |