C20H16FNO2 — CID 20926835
3-(3-fluoroanilino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione (PubChem CID 20926835) has the molecular formula C20H16FNO2 and a molecular weight of 321.35 g/mol. Its IUPAC name is 3-(3-fluoroanilino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(3-fluoroanilino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 20926835 |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 3-(3-fluoroanilino)-4-(5,6,7,8-tetrahydronaphthalen-2-yl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(Nc2cccc(F)c2)c(-c2ccc3c(c2)CCCC3)c1=O |
| InChI | InChI=1S/C20H16FNO2/c21-15-6-3-7-16(11-15)22-18-17(19(23)20(18)24)14-9-8-12-4-1-2-5-13(12)10-14/h3,6-11,22H,1-2,4-5H2 |
| InChIKey | PPDQQYYBRPAHJQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|