About (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate
(2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (PubChem CID 2092706) has the molecular formula C18H17ClFNO5
and a molecular weight of 381.79 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
Molecular Properties
| Compound Name | (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| PubChem CID | 2092706 |
| Molecular Formula | C18H17ClFNO5 |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate |
| SMILES | COc1ccc(C(=O)NCC(=O)OCc2ccc(F)cc2Cl)cc1OC |
| InChI | InChI=1S/C18H17ClFNO5/c1-24-15-6-4-11(7-16(15)25-2)18(23)21-9-17(22)26-10-12-3-5-13(20)8-14(12)19/h3-8H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | WLUNLDOKUUQIPQ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The IUPAC name of (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate (CID 2092706) is (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate.
What is the SMILES notation for (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The canonical SMILES for (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate is COc1ccc(C(=O)NCC(=O)OCc2ccc(F)cc2Cl)cc1OC.
What is the InChIKey of (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate?
The InChIKey is WLUNLDOKUUQIPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClFNO5/c1-24-15-6-4-11(7-16(15)25-2)18(23)21-9-17(22)26-10-12-3-5-13(20)8-14(12)19/h3-8H,9-10H2,1-2H3,(H,21,23).
What are the key properties of (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate?
(2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate has a molecular weight of 381.79 g/mol, XLogP of 2.97, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-fluorophenyl)methyl 2-[(3,4-dimethoxybenzoyl)amino]acetate is sourced from PubChem (CID 2092706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).