About 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide
2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 20927515) has the molecular formula C19H27FN4O5S2
and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
| PubChem CID | 20927515 |
| Molecular Formula | C19H27FN4O5S2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2cc(S(=O)(=O)NC(C)C)c(S(=O)(=O)NC(C)C)c2)cc1F |
| InChI | InChI=1S/C19H27FN4O5S2/c1-12(2)22-30(26,27)17-9-24(10-18(17)31(28,29)23-13(3)4)11-19(25)21-15-7-6-14(5)16(20)8-15/h6-10,12-13,22-23H,11H2,1-5H3,(H,21,25) |
| InChIKey | WYIUSSDOPZRCIT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 126.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide?
The IUPAC name of 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide (CID 20927515) is 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide.
What is the SMILES notation for 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide?
The canonical SMILES for 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide is Cc1ccc(NC(=O)Cn2cc(S(=O)(=O)NC(C)C)c(S(=O)(=O)NC(C)C)c2)cc1F.
What is the InChIKey of 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide?
The InChIKey is WYIUSSDOPZRCIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FN4O5S2/c1-12(2)22-30(26,27)17-9-24(10-18(17)31(28,29)23-13(3)4)11-19(25)21-15-7-6-14(5)16(20)8-15/h6-10,12-13,22-23H,11H2,1-5H3,(H,21,25).
What are the key properties of 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide?
2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide has a molecular weight of 474.58 g/mol, XLogP of 1.95, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(propan-2-ylsulfamoyl)pyrrol-1-yl]-N-(3-fluoro-4-methylphenyl)acetamide is sourced from PubChem (CID 20927515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).