C14H11N5O — CID 20927911
11,12-dimethyl-4-pyridin-4-yl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 20927911) has the molecular formula C14H11N5O and a molecular weight of 265.28 g/mol. Its IUPAC name is 11,12-dimethyl-4-pyridin-4-yl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 11,12-dimethyl-4-pyridin-4-yl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 20927911 |
| Molecular Formula | C14H11N5O |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 11,12-dimethyl-4-pyridin-4-yl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | Cc1oc2ncn3nc(-c4ccncc4)nc3c2c1C |
| InChI | InChI=1S/C14H11N5O/c1-8-9(2)20-14-11(8)13-17-12(18-19(13)7-16-14)10-3-5-15-6-4-10/h3-7H,1-2H3 |
| InChIKey | LBGDXEPNQHCTBS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |