C22H27ClN4OS — CID 20928025
1-(3-chloro-2-methylphenyl)-3,6-dimethyl-N-(3-propylsulfanylpropyl)pyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 20928025) has the molecular formula C22H27ClN4OS and a molecular weight of 431.01 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3,6-dimethyl-N-(3-propylsulfanylpropyl)pyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3,6-dimethyl-N-(3-propylsulfanylpropyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 20928025 |
| Molecular Formula | C22H27ClN4OS |
| Molecular Weight | 431.01 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3,6-dimethyl-N-(3-propylsulfanylpropyl)pyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | CCCSCCCNC(=O)c1cc(C)nc2c1c(C)nn2-c1cccc(Cl)c1C |
| InChI | InChI=1S/C22H27ClN4OS/c1-5-11-29-12-7-10-24-22(28)17-13-14(2)25-21-20(17)16(4)26-27(21)19-9-6-8-18(23)15(19)3/h6,8-9,13H,5,7,10-12H2,1-4H3,(H,24,28) |
| InChIKey | XIIVSLJLNMEWAX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.01 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|