C19H28N6O3 — CID 20929246
1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide (PubChem CID 20929246) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide.
| Compound Name | 1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 20929246 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-(3-methyl-[1,2]oxazolo[5,4-d]pyrimidin-4-yl)-N-(3-morpholin-4-ylpropyl)piperidine-4-carboxamide |
| SMILES | Cc1noc2ncnc(N3CCC(C(=O)NCCCN4CCOCC4)CC3)c12 |
| InChI | InChI=1S/C19H28N6O3/c1-14-16-17(21-13-22-19(16)28-23-14)25-7-3-15(4-8-25)18(26)20-5-2-6-24-9-11-27-12-10-24/h13,15H,2-12H2,1H3,(H,20,26) |
| InChIKey | UEXDXIDCMAZIQE-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|